Products 2403607-73-6
CAS 2403607-73-6 is the registry number for 1,3-Dimethyl-1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
1,3-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 2403607-73-6) is a chemical compound with the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. IUPAC name: 1,3-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: NRXGRQSWKOUPAL-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O3 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 1,3-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | NRXGRQSWKOUPAL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(C)C(=O)NC |
Computed by PubChem (NCBI)