Products 2403731-08-6
CAS 2403731-08-6 is the registry number for 3,5-Dibromo-2-(trifluoromethyl)pyridin-4-amine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
3,5-dibromo-2-(trifluoromethyl)pyridin-4-amine (CAS 2403731-08-6) is a chemical compound with the molecular formula C6H3Br2F3N2 and a molecular weight of 319.90 g/mol. IUPAC name: 3,5-dibromo-2-(trifluoromethyl)pyridin-4-amine. InChIKey: ADFSHCQBXFFYBM-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2F3N2 |
|---|---|
| Molecular weight | 319.90 g/mol |
| IUPAC name | 3,5-dibromo-2-(trifluoromethyl)pyridin-4-amine |
| InChIKey | ADFSHCQBXFFYBM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)C(F)(F)F)Br)N)Br |
Computed by PubChem (NCBI)