CAS 240490-00-0 appears in our catalog under these names: 2–Amino–2–(2–(trifluoromethyl)phenyl)acetic acid, 2-Amino-2-(2-(trifluoromethyl)phenyl)acetic acid, 98%, 98%, 2-(Trifluoromethyl)phenylglycine, 95%, H-DL-Phg(2-CF3)-OH, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
2-amino-2-[2-(trifluoromethyl)phenyl]acetic acid (CAS 240490-00-0) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 2-amino-2-[2-(trifluoromethyl)phenyl]acetic acid. InChIKey: WSMXFJGWNKBPHC-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-amino-2-[2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | WSMXFJGWNKBPHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)