Products 2407529-29-5
CAS 2407529-29-5 is the registry number for tert-butyl (S)-(1-(1H-indol-3-yl)propan-2-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]carbamate (CAS 2407529-29-5) is a chemical compound with the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]carbamate. InChIKey: XRRYOHBVVKHARG-NSHDSACASA-N.
| Molecular formula | C16H22N2O2 |
|---|---|
| Molecular weight | 274.36 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(1H-indol-3-yl)propan-2-yl]carbamate |
| InChIKey | XRRYOHBVVKHARG-NSHDSACASA-N |
| SMILES | C[C@@H](CC1=CNC2=CC=CC=C21)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)