CAS 2407763-16-8 is the registry number for Palonosetron Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide (CAS 2407763-16-8) is a chemical compound with the molecular formula C18H24N2O and a molecular weight of 284.4 g/mol. IUPAC name: (1R)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide. InChIKey: KOAZNWLKDYIEHQ-SJORKVTESA-N.
| Molecular formula | C18H24N2O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (1R)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| InChIKey | KOAZNWLKDYIEHQ-SJORKVTESA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2C1)C(=O)N[C@H]3CN4CCC3CC4 |
Computed by PubChem (NCBI)