Products 2407763-18-0
CAS 2407763-18-0 appears in our catalog under these names: Palonosetron hydrochloride Impurity A, Palonosetron Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide (CAS 2407763-18-0) is a chemical compound with the molecular formula C18H24N2O and a molecular weight of 284.4 g/mol. IUPAC name: (1S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide. InChIKey: KOAZNWLKDYIEHQ-IRXDYDNUSA-N.
| Molecular formula | C18H24N2O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (1S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| InChIKey | KOAZNWLKDYIEHQ-IRXDYDNUSA-N |
| SMILES | C1C[C@@H](C2=CC=CC=C2C1)C(=O)N[C@H]3CN4CCC3CC4 |
Computed by PubChem (NCBI)