CAS 698985-04-5 is the registry number for N-(5-Amino-2-methylphenyl)adamantane-1-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(5-amino-2-methylphenyl)adamantane-1-carboxamide (CAS 698985-04-5) is a chemical compound with the molecular formula C18H24N2O and a molecular weight of 284.4 g/mol. IUPAC name: N-(5-amino-2-methylphenyl)adamantane-1-carboxamide. InChIKey: OMRYCFAZVJLDTJ-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | N-(5-amino-2-methylphenyl)adamantane-1-carboxamide |
| InChIKey | OMRYCFAZVJLDTJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)NC(=O)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)