CAS 240799-61-5 is the registry number for 1-Chloro-n,n-dimethyl-4-isoquinolinecarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-chloro-N,N-dimethylisoquinoline-4-carboxamide (CAS 240799-61-5) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 1-chloro-N,N-dimethylisoquinoline-4-carboxamide. InChIKey: DRPUDBSXSRQPCY-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 1-chloro-N,N-dimethylisoquinoline-4-carboxamide |
| InChIKey | DRPUDBSXSRQPCY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN=C(C2=CC=CC=C21)Cl |
Computed by PubChem (NCBI)