CAS 2408391-89-7 appears in our catalog under these names: 3-(5-Bromo-4-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione 98%, 3-(5-Bromo-4-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, 98%, 3-(5-Bromo-4-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 250g.
3-(6-bromo-7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2408391-89-7) is a chemical compound with the molecular formula C13H10BrFN2O3 and a molecular weight of 341.13 g/mol. IUPAC name: 3-(6-bromo-7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: ZNTQEHJVUDYVAK-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFN2O3 |
|---|---|
| Molecular weight | 341.13 g/mol |
| IUPAC name | 3-(6-bromo-7-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | ZNTQEHJVUDYVAK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3F)Br |
Computed by PubChem (NCBI)