CAS 2438240-74-3 appears in our catalog under these names: 3-(6-Bromo-5-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, 3-(6-bromo-5-fluoro-1-oxoisoindolin-2-yl)piperidine-2，6-dione, 96%, 96%, Desamino lenalidomide-6-Br-5-F, 98.05%, 3-(6-Bromo-5-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 96%. Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 500 mg, 1 g, 100 mg, 250 mg.
3-(5-bromo-6-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2438240-74-3) is a chemical compound with the molecular formula C13H10BrFN2O3 and a molecular weight of 341.13 g/mol. IUPAC name: 3-(5-bromo-6-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: PKFWFANDCZTCSH-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFN2O3 |
|---|---|
| Molecular weight | 341.13 g/mol |
| IUPAC name | 3-(5-bromo-6-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | PKFWFANDCZTCSH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=CC(=C(C=C3C2=O)Br)F |
Computed by PubChem (NCBI)