CAS 2619512-24-0 appears in our catalog under these names: 3-(4-Bromo-5-fluoro-1-oxoisoindolin-2-yl)piperidine-2,6-dione, 98%, Desamino lenalidomide-4-Br-5-F. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-(7-bromo-6-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 2619512-24-0) is a chemical compound with the molecular formula C13H10BrFN2O3 and a molecular weight of 341.13 g/mol. IUPAC name: 3-(7-bromo-6-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: ZFEYSXZRWXILES-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFN2O3 |
|---|---|
| Molecular weight | 341.13 g/mol |
| IUPAC name | 3-(7-bromo-6-fluoro-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | ZFEYSXZRWXILES-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3Br)F |
Computed by PubChem (NCBI)