CAS 24085-03-8 appears in our catalog under these names: Salbutamol EP Impurity E, Salbutamol Impurity E, Salbutamol Impurity 5(Salbutamol EP Impurity E), N-Benzyl Albuterol, (1RS)-2-(Benzyl(1,1-dimethylethyl)amino)-1-(4-hydroxy-3-(hydroxymethyl)phenyl)ethanol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1x10mg.
4-[2-[benzyl(tert-butyl)amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol (CAS 24085-03-8) is a chemical compound with the molecular formula C20H27NO3 and a molecular weight of 329.4 g/mol. IUPAC name: 4-[2-[benzyl(tert-butyl)amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol. InChIKey: NZBXAYHLQSMNQS-UHFFFAOYSA-N.
| Molecular formula | C20H27NO3 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-[2-[benzyl(tert-butyl)amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| InChIKey | NZBXAYHLQSMNQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(CC1=CC=CC=C1)CC(C2=CC(=C(C=C2)O)CO)O |
Computed by PubChem (NCBI)