CAS 52346-13-1 appears in our catalog under these names: N-Benzoylmeroquinene tert-butyl ester, 95%, tert-Butyl 2-((3R,4S)-1-benzoyl-3-vinylpiperidin-4-yl)acetate, 95% mix TBC as stabilizer, N–Benzoylmeroquinene tert–Butyl Ester, N-Benzoylmeroquinene tert-Butyl Ester, >98.0%(N), N-Benzoylmeroquinene tert-Butyl Ester, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl 2-[(3R,4S)-1-benzoyl-3-ethenylpiperidin-4-yl]acetate (CAS 52346-13-1) is a chemical compound with the molecular formula C20H27NO3 and a molecular weight of 329.4 g/mol. IUPAC name: tert-butyl 2-[(3R,4S)-1-benzoyl-3-ethenylpiperidin-4-yl]acetate. InChIKey: LYFYOJAKMXFONP-RDJZCZTQSA-N.
| Molecular formula | C20H27NO3 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | tert-butyl 2-[(3R,4S)-1-benzoyl-3-ethenylpiperidin-4-yl]acetate |
| InChIKey | LYFYOJAKMXFONP-RDJZCZTQSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1CCN(C[C@@H]1C=C)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)