CAS 24086-35-9 is the registry number for 3-Methyl-1-phenyl-1H-thieno(2,3-c)pyrazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-1-phenylthieno[3,2-d]pyrazole (CAS 24086-35-9) is a chemical compound with the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. IUPAC name: 3-methyl-1-phenylthieno[3,2-d]pyrazole. InChIKey: SYEOQTDIMFRJQI-UHFFFAOYSA-N.
| Molecular formula | C12H10N2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | 3-methyl-1-phenylthieno[3,2-d]pyrazole |
| InChIKey | SYEOQTDIMFRJQI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)