Products 2408935-63-5
CAS 2408935-63-5 is the registry number for tert-Butyl (4aS,7aR)-hexahydrofuro[3,4-b]pyrazine-1(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate (CAS 2408935-63-5) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate. InChIKey: CTZAPXNYWJHZHJ-BDAKNGLRSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4aR,7aS)-2,3,4a,5,7,7a-hexahydro-1H-furo[3,4-b]pyrazine-4-carboxylate |
| InChIKey | CTZAPXNYWJHZHJ-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H]2[C@@H]1COC2 |
Computed by PubChem (NCBI)