Products 2409155-68-4
CAS 2409155-68-4 is the registry number for Fluorophenyl)hydrazono)ethylaldehyde, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
(2E)-2-[(3-fluorophenyl)hydrazinylidene]acetaldehyde (CAS 2409155-68-4) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: (2E)-2-[(3-fluorophenyl)hydrazinylidene]acetaldehyde. InChIKey: RCAGHVMAERTJGR-ONNFQVAWSA-N.
| Molecular formula | C8H7FN2O |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (2E)-2-[(3-fluorophenyl)hydrazinylidene]acetaldehyde |
| InChIKey | RCAGHVMAERTJGR-ONNFQVAWSA-N |
| SMILES | C1=CC(=CC(=C1)F)N/N=C/C=O |
Computed by PubChem (NCBI)