Products 2409963-50-2
CAS 2409963-50-2 is the registry number for PXS-4787. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-4-(benzenesulfonyl)-3-fluorobut-2-en-1-amine (CAS 2409963-50-2) is a chemical compound with the molecular formula C10H12FNO2S and a molecular weight of 229.27 g/mol. IUPAC name: (Z)-4-(benzenesulfonyl)-3-fluorobut-2-en-1-amine. InChIKey: HTUIHUIRTWMKFB-TWGQIWQCSA-N.
| Molecular formula | C10H12FNO2S |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (Z)-4-(benzenesulfonyl)-3-fluorobut-2-en-1-amine |
| InChIKey | HTUIHUIRTWMKFB-TWGQIWQCSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C/C(=C/CN)/F |
Computed by PubChem (NCBI)