Products 2410600-48-3
CAS 2410600-48-3 is the registry number for Methyl (S)-3-amino-3-(2',6'-dimethyl-[1,1'-biphenyl]-3-yl)propanoate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl (3S)-3-amino-3-[3-(2,6-dimethylphenyl)phenyl]propanoate;hydrochloride (CAS 2410600-48-3) is a chemical compound with the molecular formula C18H22ClNO2 and a molecular weight of 319.8 g/mol. IUPAC name: methyl (3S)-3-amino-3-[3-(2,6-dimethylphenyl)phenyl]propanoate;hydrochloride. InChIKey: NRMQDQOQCYUEPE-NTISSMGPSA-N.
| Molecular formula | C18H22ClNO2 |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-[3-(2,6-dimethylphenyl)phenyl]propanoate;hydrochloride |
| InChIKey | NRMQDQOQCYUEPE-NTISSMGPSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C2=CC(=CC=C2)[C@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)