CAS 219915-69-2 appears in our catalog under these names: methyl 2-(naphthalen-2-yl)-2-(piperidin-2-yl)acetate, Methylnaphthidate Hydrochloride, Methylnaphthidate Hydrochloride (HDMP-28 HCl), (±)–threo–Methylnaphthidate (hydrochloride), rel-HDMP 28 (hydrochloride), 99.70%. Offered by: Biosynth, TRC, LoGiCal, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 250mg, 5 mg, 1 mg.
Methyl (2R)-2-naphthalen-2-yl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride (CAS 219915-69-2) is a chemical compound with the molecular formula C18H22ClNO2 and a molecular weight of 319.8 g/mol. IUPAC name: methyl (2R)-2-naphthalen-2-yl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride. InChIKey: JASHBICTXRCLDI-GBNZRNLASA-N.
| Molecular formula | C18H22ClNO2 |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | methyl (2R)-2-naphthalen-2-yl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | JASHBICTXRCLDI-GBNZRNLASA-N |
| SMILES | COC(=O)[C@@H]([C@H]1CCCCN1)C2=CC3=CC=CC=C3C=C2.Cl |
Computed by PubChem (NCBI)