Products 855849-89-7

CAS 855849-89-7 is the registry number for tert-Butyl 6-chlorospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-chlorospiro[indene-1,4'-piperidine]-1'-carboxylate (CAS 855849-89-7) is a chemical compound with the molecular formula C18H22ClNO2 and a molecular weight of 319.8 g/mol. IUPAC name: tert-butyl 6-chlorospiro[indene-1,4'-piperidine]-1'-carboxylate. InChIKey: FCODHBUWEZUURU-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22ClNO2
Molecular weight319.8 g/mol
IUPAC nametert-butyl 6-chlorospiro[indene-1,4'-piperidine]-1'-carboxylate
InChIKeyFCODHBUWEZUURU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CC1)C=CC3=C2C=C(C=C3)Cl

Computed by PubChem (NCBI)