CAS 110203-91-3 appears in our catalog under these names: 2-(1-(4-Chlorophenyl)-1-phenylethoxy)-N,N-dimethylethanamine oxide, 95%, Chlorphenoxamine N-Oxide, 2-(1-(4-Chlorophenyl)-1-phenylethoxy)-N,N-dimethylethanamine oxide. Offered by: AmBeed, Mikromol, Biosynth. Available pack sizes: 1g, 100mg, 0,5g, 50mg.
2-[1-(4-chlorophenyl)-1-phenylethoxy]-N,N-dimethylethanamine oxide (CAS 110203-91-3) is a chemical compound with the molecular formula C18H22ClNO2 and a molecular weight of 319.8 g/mol. IUPAC name: 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N,N-dimethylethanamine oxide. InChIKey: SHOGSJKUFBORHU-UHFFFAOYSA-N.
| Molecular formula | C18H22ClNO2 |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | 2-[1-(4-chlorophenyl)-1-phenylethoxy]-N,N-dimethylethanamine oxide |
| InChIKey | SHOGSJKUFBORHU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCC[N+](C)(C)[O-] |
Computed by PubChem (NCBI)