CAS 2410712-08-0 is the registry number for 2-Bromo-4-chloro-6,7-dimethoxyquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-chloro-6,7-dimethoxyquinoline (CAS 2410712-08-0) is a chemical compound with the molecular formula C11H9BrClNO2 and a molecular weight of 302.55 g/mol. IUPAC name: 2-bromo-4-chloro-6,7-dimethoxyquinoline. InChIKey: JZBPWGZCDBVJFM-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO2 |
|---|---|
| Molecular weight | 302.55 g/mol |
| IUPAC name | 2-bromo-4-chloro-6,7-dimethoxyquinoline |
| InChIKey | JZBPWGZCDBVJFM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=CC(=N2)Br)Cl)OC |
Computed by PubChem (NCBI)