Products 2923549-60-2
CAS 2923549-60-2 appears in our catalog under these names: 3-(4-Bromo-2-chlorophenyl)piperidine-2,6-dione, 98%, 98%, 3-(4-Bromo-2-chlorophenyl)piperidine-2,6-dione, 98.92%, 3-(4-Bromo-2-chlorophenyl)piperidine-2,6-dione, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50 mg, 250 mg, 25 mg, 100 mg.
3-(4-bromo-2-chlorophenyl)piperidine-2,6-dione (CAS 2923549-60-2) is a chemical compound with the molecular formula C11H9BrClNO2 and a molecular weight of 302.55 g/mol. IUPAC name: 3-(4-bromo-2-chlorophenyl)piperidine-2,6-dione. InChIKey: XVMMZRCEDJZXFI-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO2 |
|---|---|
| Molecular weight | 302.55 g/mol |
| IUPAC name | 3-(4-bromo-2-chlorophenyl)piperidine-2,6-dione |
| InChIKey | XVMMZRCEDJZXFI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)