Products 3050687-70-9
CAS 3050687-70-9 appears in our catalog under these names: CRBN ligand-13 95%, 3-(3-Bromo-2-chlorophenyl)piperidine-2,6-dione, 95%, 95%, CRBN ligand-13, 97.94%, CRBN ligand-13, 97%. Offered by: Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
3-(3-bromo-2-chlorophenyl)piperidine-2,6-dione (CAS 3050687-70-9) is a chemical compound with the molecular formula C11H9BrClNO2 and a molecular weight of 302.55 g/mol. IUPAC name: 3-(3-bromo-2-chlorophenyl)piperidine-2,6-dione. InChIKey: ALZZHOGCXUFQPV-UHFFFAOYSA-N.
| Molecular formula | C11H9BrClNO2 |
|---|---|
| Molecular weight | 302.55 g/mol |
| IUPAC name | 3-(3-bromo-2-chlorophenyl)piperidine-2,6-dione |
| InChIKey | ALZZHOGCXUFQPV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C(=CC=C2)Br)Cl |
Computed by PubChem (NCBI)