Products 2411637-68-6
CAS 2411637-68-6 appears in our catalog under these names: Olmesartan Impurity 1, 1-(4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-5-yl)ethan-1-one. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-4-yl]ethanone (CAS 2411637-68-6) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: 1-[5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-4-yl]ethanone. InChIKey: SLYOSLKORVUNEK-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 1-[5-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-4-yl]ethanone |
| InChIKey | SLYOSLKORVUNEK-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1)C(C)(C)O)C(=O)C |
Computed by PubChem (NCBI)