Products 2411740-98-0
CAS 2411740-98-0 is the registry number for Antituberculosis agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-hydroxy-2-(4-hydroxyphenyl)-5-(piperidin-1-ylmethyl)chromen-4-one (CAS 2411740-98-0) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 6-hydroxy-2-(4-hydroxyphenyl)-5-(piperidin-1-ylmethyl)chromen-4-one. InChIKey: SUUJNJFIRDSZMB-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 6-hydroxy-2-(4-hydroxyphenyl)-5-(piperidin-1-ylmethyl)chromen-4-one |
| InChIKey | SUUJNJFIRDSZMB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=C(C=CC3=C2C(=O)C=C(O3)C4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)
Synonyms:
Antituberculosis agent-1, orb1688816