Products 2411815-38-6
CAS 2411815-38-6 is the registry number for 6-Hydroxybenzo[e][1,2,3]oxathiazine 2,2-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
2,2-dioxo-1,2lambda6,3-benzoxathiazin-6-ol (CAS 2411815-38-6) is a chemical compound with the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. IUPAC name: 2,2-dioxo-1,2lambda6,3-benzoxathiazin-6-ol. InChIKey: RDMWRMIKXFUKMZ-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 2,2-dioxo-1,2lambda6,3-benzoxathiazin-6-ol |
| InChIKey | RDMWRMIKXFUKMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C=NS(=O)(=O)O2 |
Computed by PubChem (NCBI)