CAS 79763-55-6 appears in our catalog under these names: Methyl 5-cyano-3,4-dihydroxythiophene-2-carboxylate, 95%, Methyl 5-cyano-3,4-dihydroxythiophene-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl 5-cyano-3,4-dihydroxythiophene-2-carboxylate (CAS 79763-55-6) is a chemical compound with the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. IUPAC name: methyl 5-cyano-3,4-dihydroxythiophene-2-carboxylate. InChIKey: VUBFZWRHRXLGPJ-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | methyl 5-cyano-3,4-dihydroxythiophene-2-carboxylate |
| InChIKey | VUBFZWRHRXLGPJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(S1)C#N)O)O |
Computed by PubChem (NCBI)