CAS 80563-77-5 appears in our catalog under these names: 4-Hydroxy-1h-1,2-benzisothiazole-1,1,3(2h)-trione, 95%, 4-Hydroxy-1H-1,2-benzisothiazole-1,1,3(2H)-trione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 500mg.
4-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one (CAS 80563-77-5) is a chemical compound with the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. IUPAC name: 4-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: XAPBTHFURNHTFN-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 4-hydroxy-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | XAPBTHFURNHTFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)S(=O)(=O)NC2=O)O |
Computed by PubChem (NCBI)