Products 871884-79-6
CAS 871884-79-6 is the registry number for 4-Sulfanylpyridine-2,6-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-sulfanylidene-1H-pyridine-2,6-dicarboxylic acid (CAS 871884-79-6) is a chemical compound with the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. IUPAC name: 4-sulfanylidene-1H-pyridine-2,6-dicarboxylic acid. InChIKey: ZYCAMEYAPIZEIQ-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 4-sulfanylidene-1H-pyridine-2,6-dicarboxylic acid |
| InChIKey | ZYCAMEYAPIZEIQ-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=CC1=S)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)