Products 2413102-60-8
CAS 2413102-60-8 is the registry number for Brivaracetam Impurity 94. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-2-[(3R)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide (CAS 2413102-60-8) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: (2S)-2-[(3R)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide. InChIKey: HDICDMIQRRQWTH-IXIJJPBFSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | (2S)-2-[(3R)-2-hydroxy-5-oxo-3-propylpyrrolidin-1-yl]butanamide |
| InChIKey | HDICDMIQRRQWTH-IXIJJPBFSA-N |
| SMILES | CCC[C@@H]1CC(=O)N(C1O)[C@@H](CC)C(=O)N |
Computed by PubChem (NCBI)