Products 2413846-73-6
CAS 2413846-73-6 appears in our catalog under these names: tert-Butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate 95%, tert-Butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg.
Tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate (CAS 2413846-73-6) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate. InChIKey: MEYHEQDHYZKZJR-RKDXNWHRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate |
| InChIKey | MEYHEQDHYZKZJR-RKDXNWHRSA-N |
| SMILES | C[C@@H]1C[C@H](CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)