CAS 955028-51-0 is the registry number for rac-tert-Butyl (3R,5S)-3-hydroxy-5-methylpiperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (3S,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate (CAS 955028-51-0) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3S,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate. InChIKey: MEYHEQDHYZKZJR-BDAKNGLRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3S,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate |
| InChIKey | MEYHEQDHYZKZJR-BDAKNGLRSA-N |
| SMILES | C[C@@H]1C[C@@H](CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)