CAS 2879251-84-8 is the registry number for Rel-tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate (CAS 2879251-84-8) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate. InChIKey: MEYHEQDHYZKZJR-RKDXNWHRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (3R,5R)-3-hydroxy-5-methylpiperidine-1-carboxylate |
| InChIKey | MEYHEQDHYZKZJR-RKDXNWHRSA-N |
| SMILES | C[C@@H]1C[C@H](CN(C1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)