Products 2413884-39-4
CAS 2413884-39-4 is the registry number for (3,3-Dimethyl-1,4-dioxan-2-yl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonamide (CAS 2413884-39-4) is a chemical compound with the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. IUPAC name: (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonamide. InChIKey: FQFUFZQHEJKLQD-UHFFFAOYSA-N.
| Molecular formula | C7H15NO4S |
|---|---|
| Molecular weight | 209.27 g/mol |
| IUPAC name | (3,3-dimethyl-1,4-dioxan-2-yl)methanesulfonamide |
| InChIKey | FQFUFZQHEJKLQD-UHFFFAOYSA-N |
| SMILES | CC1(C(OCCO1)CS(=O)(=O)N)C |
Computed by PubChem (NCBI)