CAS 276243-95-9 is the registry number for N-(3,5-Dimethylphenyl)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(3,5-dimethylphenyl)indole (CAS 276243-95-9) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)indole. InChIKey: RDYNERNMPKBLAO-UHFFFAOYSA-N.
| Molecular formula | C16H15N |
|---|---|
| Molecular weight | 221.30 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)indole |
| InChIKey | RDYNERNMPKBLAO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C=CC3=CC=CC=C32)C |
Computed by PubChem (NCBI)