Products 276243-95-9

CAS 276243-95-9 is the registry number for N-(3,5-Dimethylphenyl)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(3,5-dimethylphenyl)indole (CAS 276243-95-9) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)indole. InChIKey: RDYNERNMPKBLAO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15N
Molecular weight221.30 g/mol
IUPAC name1-(3,5-dimethylphenyl)indole
InChIKeyRDYNERNMPKBLAO-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)N2C=CC3=CC=CC=C32)C

Computed by PubChem (NCBI)