CAS 24158-31-4 is the registry number for 4-Chloro-1,3-dimethyl-1h-pyrazolo[3,4-b]quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline (CAS 24158-31-4) is a chemical compound with the molecular formula C12H10ClN3 and a molecular weight of 231.68 g/mol. IUPAC name: 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline. InChIKey: CLRNUDVGJVDYTG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 4-chloro-1,3-dimethylpyrazolo[3,4-b]quinoline |
| InChIKey | CLRNUDVGJVDYTG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC3=CC=CC=C3C(=C12)Cl)C |
Computed by PubChem (NCBI)