CAS 293292-33-8 appears in our catalog under these names: 1-(6-Chloropyrimidin-4-yl)indoline, 98+%, 1-(6-Chloro-4-pyrimidinyl)indoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(6-chloropyrimidin-4-yl)-2,3-dihydroindole (CAS 293292-33-8) is a chemical compound with the molecular formula C12H10ClN3 and a molecular weight of 231.68 g/mol. IUPAC name: 1-(6-chloropyrimidin-4-yl)-2,3-dihydroindole. InChIKey: RSEMHHFXNIKRQH-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 1-(6-chloropyrimidin-4-yl)-2,3-dihydroindole |
| InChIKey | RSEMHHFXNIKRQH-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C3=CC(=NC=N3)Cl |
Computed by PubChem (NCBI)