CAS 2883821-89-2 is the registry number for 7-Chloro-1-isopropyl-2,6-naphthyridine-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1-propan-2-yl-2,6-naphthyridine-4-carbonitrile (CAS 2883821-89-2) is a chemical compound with the molecular formula C12H10ClN3 and a molecular weight of 231.68 g/mol. IUPAC name: 7-chloro-1-propan-2-yl-2,6-naphthyridine-4-carbonitrile. InChIKey: VATZDQQTSYLWDO-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | 7-chloro-1-propan-2-yl-2,6-naphthyridine-4-carbonitrile |
| InChIKey | VATZDQQTSYLWDO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC=C(C2=CN=C(C=C21)Cl)C#N |
Computed by PubChem (NCBI)