Products 2416220-53-4
CAS 2416220-53-4 is the registry number for Benz-AP. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(6-oxophenalen-1-yl)benzamide (CAS 2416220-53-4) is a chemical compound with the molecular formula C20H13NO2 and a molecular weight of 299.3 g/mol. IUPAC name: N-(6-oxophenalen-1-yl)benzamide. InChIKey: BNTPUIOPJAVWGQ-UHFFFAOYSA-N.
| Molecular formula | C20H13NO2 |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | N-(6-oxophenalen-1-yl)benzamide |
| InChIKey | BNTPUIOPJAVWGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C3C=CC=C4C3=C(C=C2)C=CC4=O |
Computed by PubChem (NCBI)