Products 2416236-73-0

CAS 2416236-73-0 is the registry number for tert-Butyl n-[(1-aminocyclobutyl)methyl]carbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1-aminocyclobutyl)methyl]carbamate;hydrochloride (CAS 2416236-73-0) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(1-aminocyclobutyl)methyl]carbamate;hydrochloride. InChIKey: VUEQIRPVYVDATL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H21ClN2O2
Molecular weight236.74 g/mol
IUPAC nametert-butyl N-[(1-aminocyclobutyl)methyl]carbamate;hydrochloride
InChIKeyVUEQIRPVYVDATL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1(CCC1)N.Cl

Computed by PubChem (NCBI)