CAS 24167-50-8 appears in our catalog under these names: 4-Cyano-N,N-dimethylbenzamide, 98%, 4-Cyano-N,N-dimethylbenzamide, >95% (HPLC), 4–cyano–N,N–dimethylbenzamide, 4-Cyano-N,N-dimethylbenzamide, 4-Cyano-N,N-dimethylbenzamide 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg, 50mg.
4-cyano-N,N-dimethylbenzamide (CAS 24167-50-8) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 4-cyano-N,N-dimethylbenzamide. InChIKey: CPSNYKXHMCDALW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 4-cyano-N,N-dimethylbenzamide |
| InChIKey | CPSNYKXHMCDALW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)