CAS 2416910-82-0 appears in our catalog under these names: AChE/BChE/MAO-B-IN-1, 98%, AChE/BChE/MAO-B-IN-1/ 99.69% (existing batch purity), AChE/BChE/MAO–B–IN–1, AChE/BChE/MAO-B-IN-1 98%, (1-Benzylpiperidin-4-yl)methyl phenylcarbamate, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 100mg, 10mg, 25mg, 50mg, 25 mg, 10 mg.
(1-benzylpiperidin-4-yl)methyl N-phenylcarbamate (CAS 2416910-82-0) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 324.4 g/mol. IUPAC name: (1-benzylpiperidin-4-yl)methyl N-phenylcarbamate. InChIKey: IKTRKOHDYGDICC-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (1-benzylpiperidin-4-yl)methyl N-phenylcarbamate |
| InChIKey | IKTRKOHDYGDICC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1COC(=O)NC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)