CAS 2416993-14-9 is the registry number for tert-Butyl 2-formyl-1,4-dimethyl-1H-imidazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-formyl-3,5-dimethylimidazole-4-carboxylate (CAS 2416993-14-9) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: tert-butyl 2-formyl-3,5-dimethylimidazole-4-carboxylate. InChIKey: OCXSSEMIKUAUIR-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | tert-butyl 2-formyl-3,5-dimethylimidazole-4-carboxylate |
| InChIKey | OCXSSEMIKUAUIR-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=N1)C=O)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)