CAS 241798-67-4 appears in our catalog under these names: 4–Methyl–1–phenyl–1H–pyrazole–3–carboxylic acid, 4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid, 4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid, 95%, 95%, 4-Methyl-1-phenyl-1H-pyrazole-3-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
4-methyl-1-phenylpyrazole-3-carboxylic acid (CAS 241798-67-4) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 4-methyl-1-phenylpyrazole-3-carboxylic acid. InChIKey: LHRKEPMAEXHVOS-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-methyl-1-phenylpyrazole-3-carboxylic acid |
| InChIKey | LHRKEPMAEXHVOS-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)