CAS 2418716-36-4 is the registry number for tert-Butyl 3-(2-aminothiazol-5-yl)azetidine-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl 3-(2-amino-1,3-thiazol-5-yl)azetidine-1-carboxylate (CAS 2418716-36-4) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: tert-butyl 3-(2-amino-1,3-thiazol-5-yl)azetidine-1-carboxylate. InChIKey: NVJDUHRHTJVTHE-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | tert-butyl 3-(2-amino-1,3-thiazol-5-yl)azetidine-1-carboxylate |
| InChIKey | NVJDUHRHTJVTHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=CN=C(S2)N |
Computed by PubChem (NCBI)