CAS 24190-74-7 is the registry number for 4-Amino-5-chloro-2-methoxybenzamide. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 50mg, 0,5g.
4-amino-5-chloro-2-methoxybenzamide (CAS 24190-74-7) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: 4-amino-5-chloro-2-methoxybenzamide. InChIKey: BRXXTVNYHGGBKP-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 4-amino-5-chloro-2-methoxybenzamide |
| InChIKey | BRXXTVNYHGGBKP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)N)Cl)N |
Computed by PubChem (NCBI)