CAS 24277-39-2 appears in our catalog under these names: N-Boc-glutamic Acid Tert-butyl Ester, Boc–Glu–OtBu, Boc-L-Glu-OtBu, N-Boc-L-glutamic acid 1-tert-butyl ester, 99% , 1-tert-Butyl N-(tert-Butoxycarbonyl)-L-glutamate, >97.0%(HPLC)(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 100g, 25g, 1g, 10g, 50g, 500g, 1000g.
(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 24277-39-2) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: YMOYURYWGUWMFM-VIFPVBQESA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | YMOYURYWGUWMFM-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)