CAS 24321-28-6 is the registry number for Methyl (R)-2-((S)-1-Nitrosopiperidin-2-yl)-2-phenylacetate. Offered by: TRC. Available pack sizes: 100mg.
Methyl (2R)-2-[(2S)-1-nitrosopiperidin-2-yl]-2-phenylacetate (CAS 24321-28-6) is a chemical compound with the molecular formula C14H18N2O3 and a molecular weight of 262.30 g/mol. IUPAC name: methyl (2R)-2-[(2S)-1-nitrosopiperidin-2-yl]-2-phenylacetate. InChIKey: QGSDAATWYASQKL-QWHCGFSZSA-N.
| Molecular formula | C14H18N2O3 |
|---|---|
| Molecular weight | 262.30 g/mol |
| IUPAC name | methyl (2R)-2-[(2S)-1-nitrosopiperidin-2-yl]-2-phenylacetate |
| InChIKey | QGSDAATWYASQKL-QWHCGFSZSA-N |
| SMILES | COC(=O)[C@@H]([C@@H]1CCCCN1N=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)