CAS 243469-59-2 is the registry number for 2,5-Anhydro-1-azido-1-deoxy-D-glucitol. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
(2S,3S,4S,5R)-2-(azidomethyl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 243469-59-2) is a chemical compound with the molecular formula C6H11N3O4 and a molecular weight of 189.17 g/mol. IUPAC name: (2S,3S,4S,5R)-2-(azidomethyl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: SXQJFSPBUVMKMT-SLPGGIOYSA-N.
| Molecular formula | C6H11N3O4 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | (2S,3S,4S,5R)-2-(azidomethyl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | SXQJFSPBUVMKMT-SLPGGIOYSA-N |
| SMILES | C([C@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)